C14H10O2 — CID 58931547
13-methyl-8,12-dioxatetracyclo[7.6.0.02,7.011,15]pentadeca-1(9),2,4,6,11(15),13-hexaene (PubChem CID 58931547) has the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. Its IUPAC name is 13-methyl-8,12-dioxatetracyclo[7.6.0.02,7.011,15]pentadeca-1(9),2,4,6,11(15),13-hexaene.
| Compound Name | 13-methyl-8,12-dioxatetracyclo[7.6.0.02,7.011,15]pentadeca-1(9),2,4,6,11(15),13-hexaene |
|---|---|
| PubChem CID | 58931547 |
| Molecular Formula | C14H10O2 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 13-methyl-8,12-dioxatetracyclo[7.6.0.02,7.011,15]pentadeca-1(9),2,4,6,11(15),13-hexaene |
| SMILES | Cc1cc2c(o1)Cc1oc3ccccc3c1-2 |
| InChI | InChI=1S/C14H10O2/c1-8-6-10-12(15-8)7-13-14(10)9-4-2-3-5-11(9)16-13/h2-6H,7H2,1H3 |
| InChIKey | PTSHFJAVHVFENS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |