C18H16NO+ — CID 164756849
1-methyl-2-(2-methylphenyl)-3H-[1]benzofuro[3,2-b]pyrrol-1-ium (PubChem CID 164756849) has the molecular formula C18H16NO+ and a molecular weight of 262.33 g/mol. Its IUPAC name is 1-methyl-2-(2-methylphenyl)-3H-[1]benzofuro[3,2-b]pyrrol-1-ium.
| Compound Name | 1-methyl-2-(2-methylphenyl)-3H-[1]benzofuro[3,2-b]pyrrol-1-ium |
|---|---|
| PubChem CID | 164756849 |
| Molecular Formula | C18H16NO+ |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1-methyl-2-(2-methylphenyl)-3H-[1]benzofuro[3,2-b]pyrrol-1-ium |
| SMILES | Cc1ccccc1C1=[N+](C)c2c(oc3ccccc23)C1 |
| InChI | InChI=1S/C18H16NO/c1-12-7-3-4-8-13(12)15-11-17-18(19(15)2)14-9-5-6-10-16(14)20-17/h3-10H,11H2,1-2H3/q+1 |
| InChIKey | XRSHUSYSXWODET-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 16.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|