C18H15N2O+ — CID 155610288
3-methyl-4-(2-methylphenyl)-[1]benzofuro[2,3-d]pyrimidin-3-ium (PubChem CID 155610288) has the molecular formula C18H15N2O+ and a molecular weight of 275.33 g/mol. Its IUPAC name is 3-methyl-4-(2-methylphenyl)-[1]benzofuro[2,3-d]pyrimidin-3-ium.
| Compound Name | 3-methyl-4-(2-methylphenyl)-[1]benzofuro[2,3-d]pyrimidin-3-ium |
|---|---|
| PubChem CID | 155610288 |
| Molecular Formula | C18H15N2O+ |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3-methyl-4-(2-methylphenyl)-[1]benzofuro[2,3-d]pyrimidin-3-ium |
| SMILES | Cc1ccccc1-c1c2c(nc[n+]1C)oc1ccccc12 |
| InChI | InChI=1S/C18H15N2O/c1-12-7-3-4-8-13(12)17-16-14-9-5-6-10-15(14)21-18(16)19-11-20(17)2/h3-11H,1-2H3/q+1 |
| InChIKey | JZQORGFSABKXDM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|