C19H16NO+ — CID 90880561
2-methyl-1-(2-methylphenyl)-[1]benzofuro[3,2-c]pyridin-2-ium (PubChem CID 90880561) has the molecular formula C19H16NO+ and a molecular weight of 274.34 g/mol. Its IUPAC name is 2-methyl-1-(2-methylphenyl)-[1]benzofuro[3,2-c]pyridin-2-ium.
| Compound Name | 2-methyl-1-(2-methylphenyl)-[1]benzofuro[3,2-c]pyridin-2-ium |
|---|---|
| PubChem CID | 90880561 |
| Molecular Formula | C19H16NO+ |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2-methyl-1-(2-methylphenyl)-[1]benzofuro[3,2-c]pyridin-2-ium |
| SMILES | Cc1ccccc1-c1c2c(cc[n+]1C)oc1ccccc12 |
| InChI | InChI=1S/C19H16NO/c1-13-7-3-4-8-14(13)19-18-15-9-5-6-10-16(15)21-17(18)11-12-20(19)2/h3-12H,1-2H3/q+1 |
| InChIKey | UJWJHSSBEDMZPW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|