C33H28NO+ — CID 140881358
1-methyl-2-(1-methyldibenzofuran-2-yl)-3-[4-phenyl-2,6-bis(trideuteriomethyl)phenyl]pyridin-1-ium (PubChem CID 140881358) has the molecular formula C33H28NO+ and a molecular weight of 460.63 g/mol. Its IUPAC name is 1-methyl-2-(1-methyldibenzofuran-2-yl)-3-[4-phenyl-2,6-bis(trideuteriomethyl)phenyl]pyridin-1-ium.
| Compound Name | 1-methyl-2-(1-methyldibenzofuran-2-yl)-3-[4-phenyl-2,6-bis(trideuteriomethyl)phenyl]pyridin-1-ium |
|---|---|
| PubChem CID | 140881358 |
| Molecular Formula | C33H28NO+ |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 1-methyl-2-(1-methyldibenzofuran-2-yl)-3-[4-phenyl-2,6-bis(trideuteriomethyl)phenyl]pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1cc(-c2ccccc2)cc(C([2H])([2H])[2H])c1-c1ccc[n+](C)c1-c1ccc2oc3ccccc3c2c1C |
| InChI | InChI=1S/C33H28NO/c1-21-19-25(24-11-6-5-7-12-24)20-22(2)31(21)28-14-10-18-34(4)33(28)26-16-17-30-32(23(26)3)27-13-8-9-15-29(27)35-30/h5-20H,1-4H3/q+1/i1D3,2D3 |
| InChIKey | BRQMZEGTNOXBRQ-WFGJKAKNSA-N |
| XLogP | 8.34 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|