C27H24NO+ — CID 163624003
2-deuterio-6-(1,7-dimethyl-6-phenyldibenzofuran-2-yl)-1-methyl-3-(trideuteriomethyl)pyridin-1-ium (PubChem CID 163624003) has the molecular formula C27H24NO+ and a molecular weight of 382.52 g/mol. Its IUPAC name is 2-deuterio-6-(1,7-dimethyl-6-phenyldibenzofuran-2-yl)-1-methyl-3-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 2-deuterio-6-(1,7-dimethyl-6-phenyldibenzofuran-2-yl)-1-methyl-3-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 163624003 |
| Molecular Formula | C27H24NO+ |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 2-deuterio-6-(1,7-dimethyl-6-phenyldibenzofuran-2-yl)-1-methyl-3-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]c1c(C([2H])([2H])[2H])ccc(-c2ccc3oc4c(-c5ccccc5)c(C)ccc4c3c2C)[n+]1C |
| InChI | InChI=1S/C27H24NO/c1-17-10-14-23(28(4)16-17)21-13-15-24-26(19(21)3)22-12-11-18(2)25(27(22)29-24)20-8-6-5-7-9-20/h5-16H,1-4H3/q+1/i1D3,16D |
| InChIKey | WKNVQFABFAJVOC-KFHHUZHISA-N |
| XLogP | 6.67 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|