C23H24NO+ — CID 168730919
1-methyl-2-[3-methyl-7,9-bis(trideuteriomethyl)dibenzofuran-4-yl]-4,5-bis(trideuteriomethyl)pyridin-1-ium (PubChem CID 168730919) has the molecular formula C23H24NO+ and a molecular weight of 342.52 g/mol. Its IUPAC name is 1-methyl-2-[3-methyl-7,9-bis(trideuteriomethyl)dibenzofuran-4-yl]-4,5-bis(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 1-methyl-2-[3-methyl-7,9-bis(trideuteriomethyl)dibenzofuran-4-yl]-4,5-bis(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 168730919 |
| Molecular Formula | C23H24NO+ |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 1-methyl-2-[3-methyl-7,9-bis(trideuteriomethyl)dibenzofuran-4-yl]-4,5-bis(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1cc(C([2H])([2H])[2H])c2c(c1)oc1c(-c3cc(C([2H])([2H])[2H])c(C([2H])([2H])[2H])c[n+]3C)c(C)ccc12 |
| InChI | InChI=1S/C23H24NO/c1-13-9-16(4)21-18-8-7-14(2)22(23(18)25-20(21)10-13)19-11-15(3)17(5)12-24(19)6/h7-12H,1-6H3/q+1/i1D3,3D3,4D3,5D3 |
| InChIKey | OBRWGRZJTQUNHU-QAPXYEFLSA-N |
| XLogP | 5.62 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|