C17H19N2O+ — CID 123455228
5-methyl-4-(2-methylphenyl)-2-propan-2-yl-[1,3]oxazolo[4,5-c]pyridin-5-ium (PubChem CID 123455228) has the molecular formula C17H19N2O+ and a molecular weight of 267.35 g/mol. Its IUPAC name is 5-methyl-4-(2-methylphenyl)-2-propan-2-yl-[1,3]oxazolo[4,5-c]pyridin-5-ium.
| Compound Name | 5-methyl-4-(2-methylphenyl)-2-propan-2-yl-[1,3]oxazolo[4,5-c]pyridin-5-ium |
|---|---|
| PubChem CID | 123455228 |
| Molecular Formula | C17H19N2O+ |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 5-methyl-4-(2-methylphenyl)-2-propan-2-yl-[1,3]oxazolo[4,5-c]pyridin-5-ium |
| SMILES | Cc1ccccc1-c1c2nc(C(C)C)oc2cc[n+]1C |
| InChI | InChI=1S/C17H19N2O/c1-11(2)17-18-15-14(20-17)9-10-19(4)16(15)13-8-6-5-7-12(13)3/h5-11H,1-4H3/q+1 |
| InChIKey | UPXRDUMDLXJGGJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|