C20H16FN2S+ — CID 123654475
2-(4-fluorophenyl)-5-methyl-4-(2-methylphenyl)-[1,3]thiazolo[4,5-c]pyridin-5-ium (PubChem CID 123654475) has the molecular formula C20H16FN2S+ and a molecular weight of 335.43 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-methyl-4-(2-methylphenyl)-[1,3]thiazolo[4,5-c]pyridin-5-ium.
| Compound Name | 2-(4-fluorophenyl)-5-methyl-4-(2-methylphenyl)-[1,3]thiazolo[4,5-c]pyridin-5-ium |
|---|---|
| PubChem CID | 123654475 |
| Molecular Formula | C20H16FN2S+ |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 2-(4-fluorophenyl)-5-methyl-4-(2-methylphenyl)-[1,3]thiazolo[4,5-c]pyridin-5-ium |
| SMILES | Cc1ccccc1-c1c2nc(-c3ccc(F)cc3)sc2cc[n+]1C |
| InChI | InChI=1S/C20H16FN2S/c1-13-5-3-4-6-16(13)19-18-17(11-12-23(19)2)24-20(22-18)14-7-9-15(21)10-8-14/h3-12H,1-2H3/q+1 |
| InChIKey | KHXPLZAQLVCSJS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|