C22H19FNS+ — CID 140881369
3-fluoro-1-methyl-5-(2-methyl-1-benzothiophen-6-yl)-2-(2-methylphenyl)pyridin-1-ium (PubChem CID 140881369) has the molecular formula C22H19FNS+ and a molecular weight of 348.47 g/mol. Its IUPAC name is 3-fluoro-1-methyl-5-(2-methyl-1-benzothiophen-6-yl)-2-(2-methylphenyl)pyridin-1-ium.
| Compound Name | 3-fluoro-1-methyl-5-(2-methyl-1-benzothiophen-6-yl)-2-(2-methylphenyl)pyridin-1-ium |
|---|---|
| PubChem CID | 140881369 |
| Molecular Formula | C22H19FNS+ |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 3-fluoro-1-methyl-5-(2-methyl-1-benzothiophen-6-yl)-2-(2-methylphenyl)pyridin-1-ium |
| SMILES | Cc1cc2ccc(-c3cc(F)c(-c4ccccc4C)[n+](C)c3)cc2s1 |
| InChI | InChI=1S/C22H19FNS/c1-14-6-4-5-7-19(14)22-20(23)11-18(13-24(22)3)16-8-9-17-10-15(2)25-21(17)12-16/h4-13H,1-3H3/q+1 |
| InChIKey | CUJDAEBEMBBVCV-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|