C24H19F2N2+ — CID 58991387
5-(3,5-difluorophenyl)-1-methyl-2-(2-methylphenyl)-3-phenylpyrazin-1-ium (PubChem CID 58991387) has the molecular formula C24H19F2N2+ and a molecular weight of 373.43 g/mol. Its IUPAC name is 5-(3,5-difluorophenyl)-1-methyl-2-(2-methylphenyl)-3-phenylpyrazin-1-ium.
| Compound Name | 5-(3,5-difluorophenyl)-1-methyl-2-(2-methylphenyl)-3-phenylpyrazin-1-ium |
|---|---|
| PubChem CID | 58991387 |
| Molecular Formula | C24H19F2N2+ |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 5-(3,5-difluorophenyl)-1-methyl-2-(2-methylphenyl)-3-phenylpyrazin-1-ium |
| SMILES | Cc1ccccc1-c1c(-c2ccccc2)nc(-c2cc(F)cc(F)c2)c[n+]1C |
| InChI | InChI=1S/C24H19F2N2/c1-16-8-6-7-11-21(16)24-23(17-9-4-3-5-10-17)27-22(15-28(24)2)18-12-19(25)14-20(26)13-18/h3-15H,1-2H3/q+1 |
| InChIKey | VLUXYAGLQQUYHD-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|