C34H31N2+ — CID 58991398
3-(9,9-dimethylfluoren-2-yl)-1,2-dimethyl-6-(2-methylphenyl)-5-phenylpyrazin-1-ium (PubChem CID 58991398) has the molecular formula C34H31N2+ and a molecular weight of 467.64 g/mol. Its IUPAC name is 3-(9,9-dimethylfluoren-2-yl)-1,2-dimethyl-6-(2-methylphenyl)-5-phenylpyrazin-1-ium.
| Compound Name | 3-(9,9-dimethylfluoren-2-yl)-1,2-dimethyl-6-(2-methylphenyl)-5-phenylpyrazin-1-ium |
|---|---|
| PubChem CID | 58991398 |
| Molecular Formula | C34H31N2+ |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 3-(9,9-dimethylfluoren-2-yl)-1,2-dimethyl-6-(2-methylphenyl)-5-phenylpyrazin-1-ium |
| SMILES | Cc1ccccc1-c1c(-c2ccccc2)nc(-c2ccc3c(c2)C(C)(C)c2ccccc2-3)c(C)[n+]1C |
| InChI | InChI=1S/C34H31N2/c1-22-13-9-10-16-26(22)33-32(24-14-7-6-8-15-24)35-31(23(2)36(33)5)25-19-20-28-27-17-11-12-18-29(27)34(3,4)30(28)21-25/h6-21H,1-5H3/q+1 |
| InChIKey | WKJKJVLOFZPJAA-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|