C29H25N2+ — CID 58991395
1,2-dimethyl-6-(2-methylphenyl)-3-naphthalen-1-yl-5-phenylpyrazin-1-ium (PubChem CID 58991395) has the molecular formula C29H25N2+ and a molecular weight of 401.53 g/mol. Its IUPAC name is 1,2-dimethyl-6-(2-methylphenyl)-3-naphthalen-1-yl-5-phenylpyrazin-1-ium.
| Compound Name | 1,2-dimethyl-6-(2-methylphenyl)-3-naphthalen-1-yl-5-phenylpyrazin-1-ium |
|---|---|
| PubChem CID | 58991395 |
| Molecular Formula | C29H25N2+ |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 1,2-dimethyl-6-(2-methylphenyl)-3-naphthalen-1-yl-5-phenylpyrazin-1-ium |
| SMILES | Cc1ccccc1-c1c(-c2ccccc2)nc(-c2cccc3ccccc23)c(C)[n+]1C |
| InChI | InChI=1S/C29H25N2/c1-20-12-7-9-17-24(20)29-28(23-14-5-4-6-15-23)30-27(21(2)31(29)3)26-19-11-16-22-13-8-10-18-25(22)26/h4-19H,1-3H3/q+1 |
| InChIKey | TWUCHLJPFKYGIF-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|