C26H25N2+ — CID 58991414
1,2-dimethyl-6-(2-methylphenyl)-3-(3-methylphenyl)-5-phenylpyrazin-1-ium (PubChem CID 58991414) has the molecular formula C26H25N2+ and a molecular weight of 365.50 g/mol. Its IUPAC name is 1,2-dimethyl-6-(2-methylphenyl)-3-(3-methylphenyl)-5-phenylpyrazin-1-ium.
| Compound Name | 1,2-dimethyl-6-(2-methylphenyl)-3-(3-methylphenyl)-5-phenylpyrazin-1-ium |
|---|---|
| PubChem CID | 58991414 |
| Molecular Formula | C26H25N2+ |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 1,2-dimethyl-6-(2-methylphenyl)-3-(3-methylphenyl)-5-phenylpyrazin-1-ium |
| SMILES | Cc1cccc(-c2nc(-c3ccccc3)c(-c3ccccc3C)[n+](C)c2C)c1 |
| InChI | InChI=1S/C26H25N2/c1-18-11-10-15-22(17-18)24-20(3)28(4)26(23-16-9-8-12-19(23)2)25(27-24)21-13-6-5-7-14-21/h5-17H,1-4H3/q+1 |
| InChIKey | MQHPRJSFMAORNI-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|