C31H38N2+2 — CID 161077986
1,3,4,5-tetramethyl-2-(2-methylphenyl)pyridin-1-ium;1,3,4-trimethyl-2-(2-methylphenyl)pyridin-1-ium (PubChem CID 161077986) has the molecular formula C31H38N2+2 and a molecular weight of 438.66 g/mol. Its IUPAC name is 1,3,4,5-tetramethyl-2-(2-methylphenyl)pyridin-1-ium;1,3,4-trimethyl-2-(2-methylphenyl)pyridin-1-ium.
| Compound Name | 1,3,4,5-tetramethyl-2-(2-methylphenyl)pyridin-1-ium;1,3,4-trimethyl-2-(2-methylphenyl)pyridin-1-ium |
|---|---|
| PubChem CID | 161077986 |
| Molecular Formula | C31H38N2+2 |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | 1,3,4,5-tetramethyl-2-(2-methylphenyl)pyridin-1-ium;1,3,4-trimethyl-2-(2-methylphenyl)pyridin-1-ium |
| SMILES | Cc1ccccc1-c1c(C)c(C)c(C)c[n+]1C.Cc1ccccc1-c1c(C)c(C)cc[n+]1C |
| InChI | InChI=1S/C16H20N.C15H18N/c1-11-8-6-7-9-15(11)16-14(4)13(3)12(2)10-17(16)5;1-11-9-10-16(4)15(13(11)3)14-8-6-5-7-12(14)2/h6-10H,1-5H3;5-10H,1-4H3/q2*+1 |
| InChIKey | IUMROJAJNCKONG-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|