C15H15N2OS+ — CID 174213138
1,5-dimethyl-4-(2-methylphenyl)-[1,3]oxazolo[5,4-c]pyridin-5-ium-2-thione (PubChem CID 174213138) has the molecular formula C15H15N2OS+ and a molecular weight of 271.37 g/mol. Its IUPAC name is 1,5-dimethyl-4-(2-methylphenyl)-[1,3]oxazolo[5,4-c]pyridin-5-ium-2-thione.
| Compound Name | 1,5-dimethyl-4-(2-methylphenyl)-[1,3]oxazolo[5,4-c]pyridin-5-ium-2-thione |
|---|---|
| PubChem CID | 174213138 |
| Molecular Formula | C15H15N2OS+ |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 1,5-dimethyl-4-(2-methylphenyl)-[1,3]oxazolo[5,4-c]pyridin-5-ium-2-thione |
| SMILES | Cc1ccccc1-c1c2oc(=S)n(C)c2cc[n+]1C |
| InChI | InChI=1S/C15H15N2OS/c1-10-6-4-5-7-11(10)13-14-12(8-9-16(13)2)17(3)15(19)18-14/h4-9H,1-3H3/q+1 |
| InChIKey | MOALNCIJXXGQGD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|