C16H18N+ — CID 140944399
6,6-dideuterio-2-methyl-1-(2-methylphenyl)-5,7-dihydrocyclopenta[c]pyridin-2-ium (PubChem CID 140944399) has the molecular formula C16H18N+ and a molecular weight of 226.34 g/mol. Its IUPAC name is 6,6-dideuterio-2-methyl-1-(2-methylphenyl)-5,7-dihydrocyclopenta[c]pyridin-2-ium.
| Compound Name | 6,6-dideuterio-2-methyl-1-(2-methylphenyl)-5,7-dihydrocyclopenta[c]pyridin-2-ium |
|---|---|
| PubChem CID | 140944399 |
| Molecular Formula | C16H18N+ |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 6,6-dideuterio-2-methyl-1-(2-methylphenyl)-5,7-dihydrocyclopenta[c]pyridin-2-ium |
| SMILES | [2H]C1([2H])Cc2cc[n+](C)c(-c3ccccc3C)c2C1 |
| InChI | InChI=1S/C16H18N/c1-12-6-3-4-8-14(12)16-15-9-5-7-13(15)10-11-17(16)2/h3-4,6,8,10-11H,5,7,9H2,1-2H3/q+1/i5D2 |
| InChIKey | KVZLZLRZWBGWKC-BFWBPSQCSA-N |
| XLogP | 2.98 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|