C21H28N+ — CID 162785540
5-tert-butyl-5,8-dideuterio-2-methyl-1-(2-methylphenyl)-7,8-dihydro-6H-isoquinolin-2-ium (PubChem CID 162785540) has the molecular formula C21H28N+ and a molecular weight of 296.47 g/mol. Its IUPAC name is 5-tert-butyl-5,8-dideuterio-2-methyl-1-(2-methylphenyl)-7,8-dihydro-6H-isoquinolin-2-ium.
| Compound Name | 5-tert-butyl-5,8-dideuterio-2-methyl-1-(2-methylphenyl)-7,8-dihydro-6H-isoquinolin-2-ium |
|---|---|
| PubChem CID | 162785540 |
| Molecular Formula | C21H28N+ |
| Molecular Weight | 296.47 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 5-tert-butyl-5,8-dideuterio-2-methyl-1-(2-methylphenyl)-7,8-dihydro-6H-isoquinolin-2-ium |
| SMILES | [2H]C1CCC([2H])(C(C)(C)C)c2cc[n+](C)c(-c3ccccc3C)c21 |
| InChI | InChI=1S/C21H28N/c1-15-9-6-7-10-16(15)20-18-11-8-12-19(21(2,3)4)17(18)13-14-22(20)5/h6-7,9-10,13-14,19H,8,11-12H2,1-5H3/q+1/i11D,19D |
| InChIKey | UENYMBFORKISSK-VVFKZLOJSA-N |
| XLogP | 4.95 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|