C17H21N2+ — CID 140881375
3-(1-deuteriocyclopentyl)-1-methyl-2-(3-methyl-4-pyridinyl)pyridin-1-ium (PubChem CID 140881375) has the molecular formula C17H21N2+ and a molecular weight of 254.38 g/mol. Its IUPAC name is 3-(1-deuteriocyclopentyl)-1-methyl-2-(3-methyl-4-pyridinyl)pyridin-1-ium.
| Compound Name | 3-(1-deuteriocyclopentyl)-1-methyl-2-(3-methyl-4-pyridinyl)pyridin-1-ium |
|---|---|
| PubChem CID | 140881375 |
| Molecular Formula | C17H21N2+ |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 3-(1-deuteriocyclopentyl)-1-methyl-2-(3-methyl-4-pyridinyl)pyridin-1-ium |
| SMILES | [2H]C1(c2ccc[n+](C)c2-c2ccncc2C)CCCC1 |
| InChI | InChI=1S/C17H21N2/c1-13-12-18-10-9-15(13)17-16(8-5-11-19(17)2)14-6-3-4-7-14/h5,8-12,14H,3-4,6-7H2,1-2H3/q+1/i14D |
| InChIKey | DZNKBZGGOZSXDL-FCFVPJCTSA-N |
| XLogP | 3.54 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|