C15H16N+ — CID 170684386
1,5,9-trimethyl-5H-indeno[1,2-b]pyridin-1-ium (PubChem CID 170684386) has the molecular formula C15H16N+ and a molecular weight of 210.30 g/mol. Its IUPAC name is 1,5,9-trimethyl-5H-indeno[1,2-b]pyridin-1-ium.
| Compound Name | 1,5,9-trimethyl-5H-indeno[1,2-b]pyridin-1-ium |
|---|---|
| PubChem CID | 170684386 |
| Molecular Formula | C15H16N+ |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 1,5,9-trimethyl-5H-indeno[1,2-b]pyridin-1-ium |
| SMILES | Cc1cccc2c1-c1c(ccc[n+]1C)C2C |
| InChI | InChI=1S/C15H16N/c1-10-6-4-7-12-11(2)13-8-5-9-16(3)15(13)14(10)12/h4-9,11H,1-3H3/q+1 |
| InChIKey | ZCDAQGAEFVZQDJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|