C18H16N+ — CID 165172791
1,11-dimethyl-3aH-phenanthro[9,10-b]pyrrol-1-ium (PubChem CID 165172791) has the molecular formula C18H16N+ and a molecular weight of 246.33 g/mol. Its IUPAC name is 1,11-dimethyl-3aH-phenanthro[9,10-b]pyrrol-1-ium.
| Compound Name | 1,11-dimethyl-3aH-phenanthro[9,10-b]pyrrol-1-ium |
|---|---|
| PubChem CID | 165172791 |
| Molecular Formula | C18H16N+ |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 1,11-dimethyl-3aH-phenanthro[9,10-b]pyrrol-1-ium |
| SMILES | Cc1cccc2c1C1=[N+](C)C=CC1c1ccccc1-2 |
| InChI | InChI=1S/C18H16N/c1-12-6-5-9-15-13-7-3-4-8-14(13)16-10-11-19(2)18(16)17(12)15/h3-11,16H,1-2H3/q+1 |
| InChIKey | FXRLSPUWOVVUSE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|