C15H18N+ — CID 123291859
2-(2,6-dimethylphenyl)-1,3-dimethylpyridin-1-ium (PubChem CID 123291859) has the molecular formula C15H18N+ and a molecular weight of 212.32 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)-1,3-dimethylpyridin-1-ium.
| Compound Name | 2-(2,6-dimethylphenyl)-1,3-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 123291859 |
| Molecular Formula | C15H18N+ |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 2-(2,6-dimethylphenyl)-1,3-dimethylpyridin-1-ium |
| SMILES | Cc1cccc(C)c1-c1c(C)ccc[n+]1C |
| InChI | InChI=1S/C15H18N/c1-11-7-5-8-12(2)14(11)15-13(3)9-6-10-16(15)4/h5-10H,1-4H3/q+1 |
| InChIKey | YGUSFQSWVZJZMI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|