C15H12 — CID 20707574
6-methyltetracyclo[9.2.1.05,13.07,12]tetradeca-1(13),2,4,7,9,11-hexaene (PubChem CID 20707574) has the molecular formula C15H12 and a molecular weight of 192.26 g/mol. Its IUPAC name is 6-methyltetracyclo[9.2.1.05,13.07,12]tetradeca-1(13),2,4,7,9,11-hexaene.
| Compound Name | 6-methyltetracyclo[9.2.1.05,13.07,12]tetradeca-1(13),2,4,7,9,11-hexaene |
|---|---|
| PubChem CID | 20707574 |
| Molecular Formula | C15H12 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 6-methyltetracyclo[9.2.1.05,13.07,12]tetradeca-1(13),2,4,7,9,11-hexaene |
| SMILES | CC1c2cccc3c2-c2c(cccc21)C3 |
| InChI | InChI=1S/C15H12/c1-9-12-6-2-4-10-8-11-5-3-7-13(9)15(11)14(10)12/h2-7,9H,8H2,1H3 |
| InChIKey | RTOPWWUMBALKCT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |