C20H18O4 — CID 102370718
dimethyl (4S,9R)-4,5,9,10-tetrahydropyrene-4,9-dicarboxylate (PubChem CID 102370718) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is dimethyl (4S,9R)-4,5,9,10-tetrahydropyrene-4,9-dicarboxylate.
| Compound Name | dimethyl (4S,9R)-4,5,9,10-tetrahydropyrene-4,9-dicarboxylate |
|---|---|
| PubChem CID | 102370718 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | dimethyl (4S,9R)-4,5,9,10-tetrahydropyrene-4,9-dicarboxylate |
| SMILES | COC(=O)[C@H]1Cc2cccc3c2-c2c(cccc21)C[C@H]3C(=O)OC |
| InChI | InChI=1S/C20H18O4/c1-23-19(21)15-9-11-5-4-8-14-16(20(22)24-2)10-12-6-3-7-13(15)17(12)18(11)14/h3-8,15-16H,9-10H2,1-2H3/t15-,16+ |
| InChIKey | IDSKELKYHCDHGZ-IYBDPMFKSA-N |
| XLogP | 2.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |