C10H11NO2 — CID 45073772
methyl 2,3-dihydro-1H-indole-3-carboxylate (PubChem CID 45073772) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is methyl 2,3-dihydro-1H-indole-3-carboxylate.
| Compound Name | methyl 2,3-dihydro-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 45073772 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | methyl 2,3-dihydro-1H-indole-3-carboxylate |
| SMILES | COC(=O)C1CNc2ccccc21 |
| InChI | InChI=1S/C10H11NO2/c1-13-10(12)8-6-11-9-5-3-2-4-7(8)9/h2-5,8,11H,6H2,1H3 |
| InChIKey | QLMBVRCJGIGWBV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |