thiophen-2-ylmethyl 2,3-dihydro-1H-indole-3-carboxylate

C14H13NO2S — CID 80565822

IUPACthiophen-2-ylmethyl 2,3-dihydro-1H-indole-3-carboxylate
SMILESO=C(OCc1cccs1)C1CNc2ccccc21
InChIInChI=1S/C14H13NO2S/c16-14(17-9-10-4-3-7-18-10)12-8-15-13-6-2-1-5-11(12)13/h1-7,12,15H,8-9H2
InChIKeyHKJWSILVIFPDKJ-UHFFFAOYSA-N
MW259.33 g/mol
LogP3.00
Rot. Bonds3

About thiophen-2-ylmethyl 2,3-dihydro-1H-indole-3-carboxylate

thiophen-2-ylmethyl 2,3-dihydro-1H-indole-3-carboxylate (PubChem CID 80565822) has the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. Its IUPAC name is thiophen-2-ylmethyl 2,3-dihydro-1H-indole-3-carboxylate.

Molecular Properties

Compound Namethiophen-2-ylmethyl 2,3-dihydro-1H-indole-3-carboxylate
PubChem CID80565822
Molecular FormulaC14H13NO2S
Molecular Weight259.33 g/mol
Exact Mass259.07
IUPAC Namethiophen-2-ylmethyl 2,3-dihydro-1H-indole-3-carboxylate
SMILESO=C(OCc1cccs1)C1CNc2ccccc21
InChIInChI=1S/C14H13NO2S/c16-14(17-9-10-4-3-7-18-10)12-8-15-13-6-2-1-5-11(12)13/h1-7,12,15H,8-9H2
InChIKeyHKJWSILVIFPDKJ-UHFFFAOYSA-N
XLogP3.00
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.33
LogP ≤ 53.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze thiophen-2-ylmethyl 2,3-dihydro-1H-indole-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of thiophen-2-ylmethyl 2,3-dihydro-1H-indole-3-carboxylate?
The IUPAC name of thiophen-2-ylmethyl 2,3-dihydro-1H-indole-3-carboxylate (CID 80565822) is thiophen-2-ylmethyl 2,3-dihydro-1H-indole-3-carboxylate.
What is the SMILES notation for thiophen-2-ylmethyl 2,3-dihydro-1H-indole-3-carboxylate?
The canonical SMILES for thiophen-2-ylmethyl 2,3-dihydro-1H-indole-3-carboxylate is O=C(OCc1cccs1)C1CNc2ccccc21.
What is the InChIKey of thiophen-2-ylmethyl 2,3-dihydro-1H-indole-3-carboxylate?
The InChIKey is HKJWSILVIFPDKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2S/c16-14(17-9-10-4-3-7-18-10)12-8-15-13-6-2-1-5-11(12)13/h1-7,12,15H,8-9H2.
What are the key properties of thiophen-2-ylmethyl 2,3-dihydro-1H-indole-3-carboxylate?
thiophen-2-ylmethyl 2,3-dihydro-1H-indole-3-carboxylate has a molecular weight of 259.33 g/mol, XLogP of 3.00, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thiophen-2-ylmethyl 2,3-dihydro-1H-indole-3-carboxylate is sourced from PubChem (CID 80565822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).