C14H13NO2S — CID 80565822
thiophen-2-ylmethyl 2,3-dihydro-1H-indole-3-carboxylate (PubChem CID 80565822) has the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. Its IUPAC name is thiophen-2-ylmethyl 2,3-dihydro-1H-indole-3-carboxylate.
| Compound Name | thiophen-2-ylmethyl 2,3-dihydro-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 80565822 |
| Molecular Formula | C14H13NO2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | thiophen-2-ylmethyl 2,3-dihydro-1H-indole-3-carboxylate |
| SMILES | O=C(OCc1cccs1)C1CNc2ccccc21 |
| InChI | InChI=1S/C14H13NO2S/c16-14(17-9-10-4-3-7-18-10)12-8-15-13-6-2-1-5-11(12)13/h1-7,12,15H,8-9H2 |
| InChIKey | HKJWSILVIFPDKJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |