C12H17NO2S — CID 64816874
thiophen-2-ylmethyl 2-aminocyclohexane-1-carboxylate (PubChem CID 64816874) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is thiophen-2-ylmethyl 2-aminocyclohexane-1-carboxylate.
| Compound Name | thiophen-2-ylmethyl 2-aminocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 64816874 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | thiophen-2-ylmethyl 2-aminocyclohexane-1-carboxylate |
| SMILES | NC1CCCCC1C(=O)OCc1cccs1 |
| InChI | InChI=1S/C12H17NO2S/c13-11-6-2-1-5-10(11)12(14)15-8-9-4-3-7-16-9/h3-4,7,10-11H,1-2,5-6,8,13H2 |
| InChIKey | PJKIHFUJTSUFCQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |