C21H23NO2 — CID 140639603
trans-9H-fluoren-9-ylmethyl (1R,2R)-2-aminocyclohexane-1-carboxylate (PubChem CID 140639603) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is trans-9H-fluoren-9-ylmethyl (1R,2R)-2-aminocyclohexane-1-carboxylate.
| Compound Name | trans-9H-fluoren-9-ylmethyl (1R,2R)-2-aminocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 140639603 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | trans-9H-fluoren-9-ylmethyl (1R,2R)-2-aminocyclohexane-1-carboxylate |
| SMILES | N[C@@H]1CCCC[C@H]1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H23NO2/c22-20-12-6-5-11-18(20)21(23)24-13-19-16-9-3-1-7-14(16)15-8-2-4-10-17(15)19/h1-4,7-10,18-20H,5-6,11-13,22H2/t18-,20-/m1/s1 |
| InChIKey | FURIPIBJYQVAOC-UYAOXDASSA-N |
| XLogP | 3.86 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |