C13H18ClNO2 — CID 163396077
cis-benzyl (1S,2R)-2-aminocyclopentane-1-carboxylate;hydrochloride (PubChem CID 163396077) has the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. Its IUPAC name is cis-benzyl (1S,2R)-2-aminocyclopentane-1-carboxylate;hydrochloride.
| Compound Name | cis-benzyl (1S,2R)-2-aminocyclopentane-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 163396077 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.74 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | cis-benzyl (1S,2R)-2-aminocyclopentane-1-carboxylate;hydrochloride |
| SMILES | Cl.N[C@@H]1CCC[C@@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H17NO2.ClH/c14-12-8-4-7-11(12)13(15)16-9-10-5-2-1-3-6-10;/h1-3,5-6,11-12H,4,7-9,14H2;1H/t11-,12+;/m0./s1 |
| InChIKey | RHSTXMZVLICGJK-ZVWHLABXSA-N |
| XLogP | 2.28 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.74 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |