C14H21N3O2 — CID 170211260
cis-(3,5-diaminophenyl)methyl (1S,2R)-2-aminocyclohexane-1-carboxylate (PubChem CID 170211260) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is cis-(3,5-diaminophenyl)methyl (1S,2R)-2-aminocyclohexane-1-carboxylate.
| Compound Name | cis-(3,5-diaminophenyl)methyl (1S,2R)-2-aminocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 170211260 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | cis-(3,5-diaminophenyl)methyl (1S,2R)-2-aminocyclohexane-1-carboxylate |
| SMILES | Nc1cc(N)cc(COC(=O)[C@H]2CCCC[C@H]2N)c1 |
| InChI | InChI=1S/C14H21N3O2/c15-10-5-9(6-11(16)7-10)8-19-14(18)12-3-1-2-4-13(12)17/h5-7,12-13H,1-4,8,15-17H2/t12-,13+/m0/s1 |
| InChIKey | ZTMDGNAGQCZFJI-QWHCGFSZSA-N |
| XLogP | 1.41 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|