C8H14N2O3 — CID 91289585
carbamoyl 2-aminocyclohexane-1-carboxylate (PubChem CID 91289585) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is carbamoyl 2-aminocyclohexane-1-carboxylate.
| Compound Name | carbamoyl 2-aminocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 91289585 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | carbamoyl 2-aminocyclohexane-1-carboxylate |
| SMILES | NC(=O)OC(=O)C1CCCCC1N |
| InChI | InChI=1S/C8H14N2O3/c9-6-4-2-1-3-5(6)7(11)13-8(10)12/h5-6H,1-4,9H2,(H2,10,12) |
| InChIKey | SNOAXGFGIKQMLZ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|