C7H13NO2 — CID 2724639
cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid (PubChem CID 2724639) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid.
| Compound Name | cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 2724639 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid |
| SMILES | N[C@H]1CCCC[C@H]1C(=O)O |
| InChI | InChI=1S/C7H13NO2/c8-6-4-2-1-3-5(6)7(9)10/h5-6H,1-4,8H2,(H,9,10)/t5-,6+/m1/s1 |
| InChIKey | USQHEVWOPJDAAX-RITPCOANSA-N |
| XLogP | 0.59 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |