About cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid;hydrobromide
cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid;hydrobromide (PubChem CID 24751167) has the molecular formula C7H14BrNO2
and a molecular weight of 224.10 g/mol. Its IUPAC name is cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid;hydrobromide.
Analyze cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid;hydrobromide?
The IUPAC name of cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid;hydrobromide (CID 24751167) is cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid;hydrobromide.
What is the SMILES notation for cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid;hydrobromide?
The canonical SMILES for cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid;hydrobromide is Br.N[C@H]1CCCC[C@H]1C(=O)O.
What is the InChIKey of cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid;hydrobromide?
The InChIKey is HHDQBZQDXPSNBI-IBTYICNHSA-N. The full InChI is InChI=1S/C7H13NO2.BrH/c8-6-4-2-1-3-5(6)7(9)10;/h5-6H,1-4,8H2,(H,9,10);1H/t5-,6+;/m1./s1.
What are the key properties of cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid;hydrobromide?
cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid;hydrobromide has a molecular weight of 224.10 g/mol, XLogP of 1.17, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid;hydrobromide is sourced from PubChem (CID 24751167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).