C8H10F3NO3 — CID 118354192
cis-(2,2,2-trifluoroacetyl) (1S,2R)-2-aminocyclopentane-1-carboxylate (PubChem CID 118354192) has the molecular formula C8H10F3NO3 and a molecular weight of 225.17 g/mol. Its IUPAC name is cis-(2,2,2-trifluoroacetyl) (1S,2R)-2-aminocyclopentane-1-carboxylate.
| Compound Name | cis-(2,2,2-trifluoroacetyl) (1S,2R)-2-aminocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 118354192 |
| Molecular Formula | C8H10F3NO3 |
| Molecular Weight | 225.17 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | cis-(2,2,2-trifluoroacetyl) (1S,2R)-2-aminocyclopentane-1-carboxylate |
| SMILES | N[C@@H]1CCC[C@@H]1C(=O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H10F3NO3/c9-8(10,11)7(14)15-6(13)4-2-1-3-5(4)12/h4-5H,1-3,12H2/t4-,5+/m0/s1 |
| InChIKey | YKDRKQUVPLNJLE-CRCLSJGQSA-N |
| XLogP | 0.75 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.17 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|