C12H10F5NO2 — CID 87764987
cis-(2,3,4,5,6-pentafluorophenyl) (1R,2S)-2-aminocyclopentane-1-carboxylate (PubChem CID 87764987) has the molecular formula C12H10F5NO2 and a molecular weight of 295.21 g/mol. Its IUPAC name is cis-(2,3,4,5,6-pentafluorophenyl) (1R,2S)-2-aminocyclopentane-1-carboxylate.
| Compound Name | cis-(2,3,4,5,6-pentafluorophenyl) (1R,2S)-2-aminocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 87764987 |
| Molecular Formula | C12H10F5NO2 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | cis-(2,3,4,5,6-pentafluorophenyl) (1R,2S)-2-aminocyclopentane-1-carboxylate |
| SMILES | N[C@H]1CCC[C@H]1C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H10F5NO2/c13-6-7(14)9(16)11(10(17)8(6)15)20-12(19)4-2-1-3-5(4)18/h4-5H,1-3,18H2/t4-,5+/m1/s1 |
| InChIKey | FOIAEKDEGKAKNV-UHNVWZDZSA-N |
| XLogP | 2.41 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|