C15H16I2O5 — CID 171737166
2-[(4-hydroxy-3,5-diiodophenyl)methoxycarbonyl]cyclohexane-1-carboxylic acid (PubChem CID 171737166) has the molecular formula C15H16I2O5 and a molecular weight of 530.10 g/mol. Its IUPAC name is 2-[(4-hydroxy-3,5-diiodophenyl)methoxycarbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[(4-hydroxy-3,5-diiodophenyl)methoxycarbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 171737166 |
| Molecular Formula | C15H16I2O5 |
| Molecular Weight | 530.10 g/mol |
| Exact Mass | 529.91 |
| IUPAC Name | 2-[(4-hydroxy-3,5-diiodophenyl)methoxycarbonyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCCC1C(=O)OCc1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C15H16I2O5/c16-11-5-8(6-12(17)13(11)18)7-22-15(21)10-4-2-1-3-9(10)14(19)20/h5-6,9-10,18H,1-4,7H2,(H,19,20) |
| InChIKey | OPCLZGFAHFUIRV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.10 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|