C14H16I2O3 — CID 76964833
cis-(1R,2S)-2-[(4-hydroxy-3,5-diiodophenyl)methyl]cyclohexane-1-carboxylic acid (PubChem CID 76964833) has the molecular formula C14H16I2O3 and a molecular weight of 486.09 g/mol. Its IUPAC name is cis-(1R,2S)-2-[(4-hydroxy-3,5-diiodophenyl)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1R,2S)-2-[(4-hydroxy-3,5-diiodophenyl)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 76964833 |
| Molecular Formula | C14H16I2O3 |
| Molecular Weight | 486.09 g/mol |
| Exact Mass | 485.92 |
| IUPAC Name | cis-(1R,2S)-2-[(4-hydroxy-3,5-diiodophenyl)methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCC[C@H]1Cc1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C14H16I2O3/c15-11-6-8(7-12(16)13(11)17)5-9-3-1-2-4-10(9)14(18)19/h6-7,9-10,17H,1-5H2,(H,18,19)/t9-,10+/m0/s1 |
| InChIKey | BGDIOASGXLPOBQ-VHSXEESVSA-N |
| XLogP | 4.03 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.09 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|