C11H13BrO3 — CID 130877489
2-[(5-bromofuran-3-yl)methyl]cyclopentane-1-carboxylic acid (PubChem CID 130877489) has the molecular formula C11H13BrO3 and a molecular weight of 273.13 g/mol. Its IUPAC name is 2-[(5-bromofuran-3-yl)methyl]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[(5-bromofuran-3-yl)methyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 130877489 |
| Molecular Formula | C11H13BrO3 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 2-[(5-bromofuran-3-yl)methyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC1Cc1coc(Br)c1 |
| InChI | InChI=1S/C11H13BrO3/c12-10-5-7(6-15-10)4-8-2-1-3-9(8)11(13)14/h5-6,8-9H,1-4H2,(H,13,14) |
| InChIKey | BKUDWKYZESTJEV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |