C16H19IO5 — CID 174247178
2-[(4-hydroxy-3-iodo-5-methylphenyl)methoxycarbonyl]cyclohexane-1-carboxylic acid (PubChem CID 174247178) has the molecular formula C16H19IO5 and a molecular weight of 418.23 g/mol. Its IUPAC name is 2-[(4-hydroxy-3-iodo-5-methylphenyl)methoxycarbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[(4-hydroxy-3-iodo-5-methylphenyl)methoxycarbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 174247178 |
| Molecular Formula | C16H19IO5 |
| Molecular Weight | 418.23 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | 2-[(4-hydroxy-3-iodo-5-methylphenyl)methoxycarbonyl]cyclohexane-1-carboxylic acid |
| SMILES | Cc1cc(COC(=O)C2CCCCC2C(=O)O)cc(I)c1O |
| InChI | InChI=1S/C16H19IO5/c1-9-6-10(7-13(17)14(9)18)8-22-16(21)12-5-3-2-4-11(12)15(19)20/h6-7,11-12,18H,2-5,8H2,1H3,(H,19,20) |
| InChIKey | NSHMAECPJYYRGO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.23 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|