C18H26O8 — CID 7052272
cis-(1R,2S)-2-[2-[(1R,2R)-2-carboxycyclohexanecarbonyl]oxyethoxycarbonyl]cyclohexane-1-carboxylic acid (PubChem CID 7052272) has the molecular formula C18H26O8 and a molecular weight of 370.40 g/mol. Its IUPAC name is cis-(1R,2S)-2-[2-[(1R,2R)-2-carboxycyclohexanecarbonyl]oxyethoxycarbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1R,2S)-2-[2-[(1R,2R)-2-carboxycyclohexanecarbonyl]oxyethoxycarbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 7052272 |
| Molecular Formula | C18H26O8 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | cis-(1R,2S)-2-[2-[(1R,2R)-2-carboxycyclohexanecarbonyl]oxyethoxycarbonyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(OCCOC(=O)[C@@H]1CCCC[C@H]1C(=O)O)[C@H]1CCCC[C@H]1C(=O)O |
| InChI | InChI=1S/C18H26O8/c19-15(20)11-5-1-3-7-13(11)17(23)25-9-10-26-18(24)14-8-4-2-6-12(14)16(21)22/h11-14H,1-10H2,(H,19,20)(H,21,22)/t11-,12-,13-,14+/m1/s1 |
| InChIKey | PDZQDZYDKNSOJM-SYQHCUMBSA-N |
| XLogP | 1.85 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|