C20H30O7 — CID 11903802
cis-(1R,2S)-2-[5-[(1R,2S)-2-carboxycyclohexanecarbonyl]oxypentanoyl]cyclohexane-1-carboxylic acid (PubChem CID 11903802) has the molecular formula C20H30O7 and a molecular weight of 382.45 g/mol. Its IUPAC name is cis-(1R,2S)-2-[5-[(1R,2S)-2-carboxycyclohexanecarbonyl]oxypentanoyl]cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1R,2S)-2-[5-[(1R,2S)-2-carboxycyclohexanecarbonyl]oxypentanoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 11903802 |
| Molecular Formula | C20H30O7 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | cis-(1R,2S)-2-[5-[(1R,2S)-2-carboxycyclohexanecarbonyl]oxypentanoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCC[C@H]1C(=O)OCCCCC(=O)[C@H]1CCCC[C@H]1C(=O)O |
| InChI | InChI=1S/C20H30O7/c21-17(13-7-1-2-8-14(13)18(22)23)11-5-6-12-27-20(26)16-10-4-3-9-15(16)19(24)25/h13-16H,1-12H2,(H,22,23)(H,24,25)/t13-,14+,15-,16+/m0/s1 |
| InChIKey | SWEPVZSFRFBDCZ-XUWVNRHRSA-N |
| XLogP | 3.05 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|