C17H30O5 — CID 102105765
2-(7-hydroxy-4-methyloctoxy)carbonylcyclohexane-1-carboxylic acid (PubChem CID 102105765) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is 2-(7-hydroxy-4-methyloctoxy)carbonylcyclohexane-1-carboxylic acid.
| Compound Name | 2-(7-hydroxy-4-methyloctoxy)carbonylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 102105765 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 2-(7-hydroxy-4-methyloctoxy)carbonylcyclohexane-1-carboxylic acid |
| SMILES | CC(O)CCC(C)CCCOC(=O)C1CCCCC1C(=O)O |
| InChI | InChI=1S/C17H30O5/c1-12(9-10-13(2)18)6-5-11-22-17(21)15-8-4-3-7-14(15)16(19)20/h12-15,18H,3-11H2,1-2H3,(H,19,20) |
| InChIKey | WPTRTTWYMWWUTQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|