C22H32O8 — CID 154604117
2-[2-[2-[2-(2-phenoxyethoxy)ethoxy]ethoxy]ethoxycarbonyl]cyclohexane-1-carboxylic acid (PubChem CID 154604117) has the molecular formula C22H32O8 and a molecular weight of 424.49 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-phenoxyethoxy)ethoxy]ethoxy]ethoxycarbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[2-[2-[2-(2-phenoxyethoxy)ethoxy]ethoxy]ethoxycarbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 154604117 |
| Molecular Formula | C22H32O8 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 2-[2-[2-[2-(2-phenoxyethoxy)ethoxy]ethoxy]ethoxycarbonyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCCC1C(=O)OCCOCCOCCOCCOc1ccccc1 |
| InChI | InChI=1S/C22H32O8/c23-21(24)19-8-4-5-9-20(19)22(25)30-17-15-28-13-11-26-10-12-27-14-16-29-18-6-2-1-3-7-18/h1-3,6-7,19-20H,4-5,8-17H2,(H,23,24) |
| InChIKey | KGCCBDPSRIHGHH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|