C13H15BrO3 — CID 55314844
2-(4-bromophenoxy)ethyl 2-methylcyclopropane-1-carboxylate (PubChem CID 55314844) has the molecular formula C13H15BrO3 and a molecular weight of 299.16 g/mol. Its IUPAC name is 2-(4-bromophenoxy)ethyl 2-methylcyclopropane-1-carboxylate.
| Compound Name | 2-(4-bromophenoxy)ethyl 2-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 55314844 |
| Molecular Formula | C13H15BrO3 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 2-(4-bromophenoxy)ethyl 2-methylcyclopropane-1-carboxylate |
| SMILES | CC1CC1C(=O)OCCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H15BrO3/c1-9-8-12(9)13(15)17-7-6-16-11-4-2-10(14)3-5-11/h2-5,9,12H,6-8H2,1H3 |
| InChIKey | RNRAOHMDZZECGK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|