About trans-propyl (1R,2R)-2-methylcyclopropane-1-carboxylate
trans-propyl (1R,2R)-2-methylcyclopropane-1-carboxylate (PubChem CID 93032108) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is trans-propyl (1R,2R)-2-methylcyclopropane-1-carboxylate.
Analyze trans-propyl (1R,2R)-2-methylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-propyl (1R,2R)-2-methylcyclopropane-1-carboxylate?
The IUPAC name of trans-propyl (1R,2R)-2-methylcyclopropane-1-carboxylate (CID 93032108) is trans-propyl (1R,2R)-2-methylcyclopropane-1-carboxylate.
What is the SMILES notation for trans-propyl (1R,2R)-2-methylcyclopropane-1-carboxylate?
The canonical SMILES for trans-propyl (1R,2R)-2-methylcyclopropane-1-carboxylate is CCCOC(=O)[C@@H]1C[C@H]1C.
What is the InChIKey of trans-propyl (1R,2R)-2-methylcyclopropane-1-carboxylate?
The InChIKey is JHNGVHNJWOCYIM-RNFRBKRXSA-N. The full InChI is InChI=1S/C8H14O2/c1-3-4-10-8(9)7-5-6(7)2/h6-7H,3-5H2,1-2H3/t6-,7-/m1/s1.
What are the key properties of trans-propyl (1R,2R)-2-methylcyclopropane-1-carboxylate?
trans-propyl (1R,2R)-2-methylcyclopropane-1-carboxylate has a molecular weight of 142.20 g/mol, XLogP of 1.60, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-propyl (1R,2R)-2-methylcyclopropane-1-carboxylate is sourced from PubChem (CID 93032108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).