C9H18NO2+ — CID 176725428
[(1S,3R,4S)-3-ethoxycarbonyl-4-methylcyclopentyl]azanium (PubChem CID 176725428) has the molecular formula C9H18NO2+ and a molecular weight of 172.25 g/mol. Its IUPAC name is [(1S,3R,4S)-3-ethoxycarbonyl-4-methylcyclopentyl]azanium.
| Compound Name | [(1S,3R,4S)-3-ethoxycarbonyl-4-methylcyclopentyl]azanium |
|---|---|
| PubChem CID | 176725428 |
| Molecular Formula | C9H18NO2+ |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | [(1S,3R,4S)-3-ethoxycarbonyl-4-methylcyclopentyl]azanium |
| SMILES | CCOC(=O)[C@@H]1C[C@@H]([NH3+])C[C@@H]1C |
| InChI | InChI=1S/C9H17NO2/c1-3-12-9(11)8-5-7(10)4-6(8)2/h6-8H,3-5,10H2,1-2H3/p+1/t6-,7-,8+/m0/s1 |
| InChIKey | PKJAOZZRXMAAMP-BIIVOSGPSA-O |
| XLogP | 0.21 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |