C10H17IO2 — CID 11208673
ethyl (1R,2R,5R)-5-iodo-2-methylcyclohexane-1-carboxylate (PubChem CID 11208673) has the molecular formula C10H17IO2 and a molecular weight of 296.15 g/mol. Its IUPAC name is ethyl (1R,2R,5R)-5-iodo-2-methylcyclohexane-1-carboxylate.
| Compound Name | ethyl (1R,2R,5R)-5-iodo-2-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 11208673 |
| Molecular Formula | C10H17IO2 |
| Molecular Weight | 296.15 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | ethyl (1R,2R,5R)-5-iodo-2-methylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@H](I)CC[C@H]1C |
| InChI | InChI=1S/C10H17IO2/c1-3-13-10(12)9-6-8(11)5-4-7(9)2/h7-9H,3-6H2,1-2H3/t7-,8-,9-/m1/s1 |
| InChIKey | JPBJPDNMZHDUCD-IWSPIJDZSA-N |
| XLogP | 2.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.15 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|