C7H9ClO3 — CID 12547530
trans-ethyl (1R,2R)-2-carbonochloridoylcyclopropane-1-carboxylate (PubChem CID 12547530) has the molecular formula C7H9ClO3 and a molecular weight of 176.60 g/mol. Its IUPAC name is trans-ethyl (1R,2R)-2-carbonochloridoylcyclopropane-1-carboxylate.
| Compound Name | trans-ethyl (1R,2R)-2-carbonochloridoylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 12547530 |
| Molecular Formula | C7H9ClO3 |
| Molecular Weight | 176.60 g/mol |
| Exact Mass | 176.02 |
| IUPAC Name | trans-ethyl (1R,2R)-2-carbonochloridoylcyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@H]1C(=O)Cl |
| InChI | InChI=1S/C7H9ClO3/c1-2-11-7(10)5-3-4(5)6(8)9/h4-5H,2-3H2,1H3/t4-,5-/m1/s1 |
| InChIKey | NTNBNHCYSBPWGE-RFZPGFLSSA-N |
| XLogP | 0.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.60 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|