C9H15NO3 — CID 138040639
cis-ethyl (1S,2R)-2-(C-ethoxycarbonimidoyl)cyclopropane-1-carboxylate (PubChem CID 138040639) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is cis-ethyl (1S,2R)-2-(C-ethoxycarbonimidoyl)cyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1S,2R)-2-(C-ethoxycarbonimidoyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 138040639 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | cis-ethyl (1S,2R)-2-(C-ethoxycarbonimidoyl)cyclopropane-1-carboxylate |
| SMILES | [H]/N=C(\OCC)[C@@H]1C[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C9H15NO3/c1-3-12-8(10)6-5-7(6)9(11)13-4-2/h6-7,10H,3-5H2,1-2H3/b10-8-/t6-,7+/m1/s1 |
| InChIKey | DOPURGVTRJWLNM-QWZDHLHUSA-N |
| XLogP | 1.20 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|