C10H16O5 — CID 58624990
dipropyl oxirane-2,3-dicarboxylate (PubChem CID 58624990) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is dipropyl oxirane-2,3-dicarboxylate.
| Compound Name | dipropyl oxirane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 58624990 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | dipropyl oxirane-2,3-dicarboxylate |
| SMILES | CCCOC(=O)C1OC1C(=O)OCCC |
| InChI | InChI=1S/C10H16O5/c1-3-5-13-9(11)7-8(15-7)10(12)14-6-4-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | HTBUGCBUXMHNEX-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|